C23H28N4O3S — CID 168797752
6-[1-[(3,6-dimethyl-2,3-dihydro-1-benzofuran-5-yl)sulfonyl]piperidin-4-yl]-2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 168797752) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is 6-[1-[(3,6-dimethyl-2,3-dihydro-1-benzofuran-5-yl)sulfonyl]piperidin-4-yl]-2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 6-[1-[(3,6-dimethyl-2,3-dihydro-1-benzofuran-5-yl)sulfonyl]piperidin-4-yl]-2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 168797752 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 6-[1-[(3,6-dimethyl-2,3-dihydro-1-benzofuran-5-yl)sulfonyl]piperidin-4-yl]-2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1nc2cc(C)c(C3CCN(S(=O)(=O)c4cc5c(cc4C)OCC5C)CC3)cn2n1 |
| InChI | InChI=1S/C23H28N4O3S/c1-14-10-23-24-17(4)25-27(23)12-20(14)18-5-7-26(8-6-18)31(28,29)22-11-19-16(3)13-30-21(19)9-15(22)2/h9-12,16,18H,5-8,13H2,1-4H3 |
| InChIKey | NLOAMSQHFXKNFE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |