C19H21B4N3O4S — CID 174079116
CID 174079116 (PubChem CID 174079116) has the molecular formula C19H21B4N3O4S and a molecular weight of 430.71 g/mol.
| Compound Name | CID 174079116 |
|---|---|
| PubChem CID | 174079116 |
| Molecular Formula | C19H21B4N3O4S |
| Molecular Weight | 430.71 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | — |
| SMILES | [B]C1([B])Oc2cc(C)c(C3CCN(S(=O)(=O)c4cnc(C)n4C)CC3)cc2OC1([B])[B] |
| InChI | InChI=1S/C19H21B4N3O4S/c1-11-8-15-16(30-19(22,23)18(20,21)29-15)9-14(11)13-4-6-26(7-5-13)31(27,28)17-10-24-12(2)25(17)3/h8-10,13H,4-7H2,1-3H3 |
| InChIKey | XTYPFGZQPNPHDU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.71 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|