C19H16N2 — CID 168798283
3-(2-methylcarbazol-9-yl)aniline (PubChem CID 168798283) has the molecular formula C19H16N2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-(2-methylcarbazol-9-yl)aniline.
| Compound Name | 3-(2-methylcarbazol-9-yl)aniline |
|---|---|
| PubChem CID | 168798283 |
| Molecular Formula | C19H16N2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 3-(2-methylcarbazol-9-yl)aniline |
| SMILES | Cc1ccc2c3ccccc3n(-c3cccc(N)c3)c2c1 |
| InChI | InChI=1S/C19H16N2/c1-13-9-10-17-16-7-2-3-8-18(16)21(19(17)11-13)15-6-4-5-14(20)12-15/h2-12H,20H2,1H3 |
| InChIKey | KEDJYLZNYYQDEW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|