C58H42N2S — CID 168798656
2-(3-dibenzothiophen-1-ylphenyl)-4-[5'-(4-isocyanophenyl)spiro[adamantane-2,9'-fluorene]-3'-yl]-6-phenylpyridine (PubChem CID 168798656) has the molecular formula C58H42N2S and a molecular weight of 799.06 g/mol. Its IUPAC name is 2-(3-dibenzothiophen-1-ylphenyl)-4-[5'-(4-isocyanophenyl)spiro[adamantane-2,9'-fluorene]-3'-yl]-6-phenylpyridine.
| Compound Name | 2-(3-dibenzothiophen-1-ylphenyl)-4-[5'-(4-isocyanophenyl)spiro[adamantane-2,9'-fluorene]-3'-yl]-6-phenylpyridine |
|---|---|
| PubChem CID | 168798656 |
| Molecular Formula | C58H42N2S |
| Molecular Weight | 799.06 g/mol |
| Exact Mass | 798.31 |
| IUPAC Name | 2-(3-dibenzothiophen-1-ylphenyl)-4-[5'-(4-isocyanophenyl)spiro[adamantane-2,9'-fluorene]-3'-yl]-6-phenylpyridine |
| SMILES | [C-]#[N+]c1ccc(-c2cccc3c2-c2cc(-c4cc(-c5ccccc5)nc(-c5cccc(-c6cccc7sc8ccccc8c67)c5)c4)ccc2C32C3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C58H42N2S/c1-59-45-23-20-37(21-24-45)46-15-8-17-51-56(46)49-32-39(22-25-50(49)58(51)43-27-35-26-36(29-43)30-44(58)28-35)42-33-52(38-10-3-2-4-11-38)60-53(34-42)41-13-7-12-40(31-41)47-16-9-19-55-57(47)48-14-5-6-18-54(48)61-55/h2-25,31-36,43-44H,26-30H2 |
| InChIKey | AZCPUYNOAUTUBT-UHFFFAOYSA-N |
| XLogP | 16.06 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.06 |
| LogP ≤ 5 | 16.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|