C29H30FN2S+ — CID 168811741
1-[2,4-di(propan-2-yl)dibenzothiophen-3-yl]-2-(4-fluoro-2-methylphenyl)-3-methylimidazol-3-ium (PubChem CID 168811741) has the molecular formula C29H30FN2S+ and a molecular weight of 457.64 g/mol. Its IUPAC name is 1-[2,4-di(propan-2-yl)dibenzothiophen-3-yl]-2-(4-fluoro-2-methylphenyl)-3-methylimidazol-3-ium.
| Compound Name | 1-[2,4-di(propan-2-yl)dibenzothiophen-3-yl]-2-(4-fluoro-2-methylphenyl)-3-methylimidazol-3-ium |
|---|---|
| PubChem CID | 168811741 |
| Molecular Formula | C29H30FN2S+ |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 1-[2,4-di(propan-2-yl)dibenzothiophen-3-yl]-2-(4-fluoro-2-methylphenyl)-3-methylimidazol-3-ium |
| SMILES | Cc1cc(F)ccc1-c1n(-c2c(C(C)C)cc3c(sc4ccccc43)c2C(C)C)cc[n+]1C |
| InChI | InChI=1S/C29H30FN2S/c1-17(2)23-16-24-22-9-7-8-10-25(22)33-28(24)26(18(3)4)27(23)32-14-13-31(6)29(32)21-12-11-20(30)15-19(21)5/h7-18H,1-6H3/q+1 |
| InChIKey | IKYBJHNOLNEPSA-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|