C26H35FN4O2S — CID 168812981
4-[(2R)-4-cyclobutylsulfonyl-1-(2-methylpropyl)piperazin-2-yl]-N-(4-fluorophenyl)-2-methanimidoyl-5-methylaniline (PubChem CID 168812981) has the molecular formula C26H35FN4O2S and a molecular weight of 486.66 g/mol. Its IUPAC name is 4-[(2R)-4-cyclobutylsulfonyl-1-(2-methylpropyl)piperazin-2-yl]-N-(4-fluorophenyl)-2-methanimidoyl-5-methylaniline.
| Compound Name | 4-[(2R)-4-cyclobutylsulfonyl-1-(2-methylpropyl)piperazin-2-yl]-N-(4-fluorophenyl)-2-methanimidoyl-5-methylaniline |
|---|---|
| PubChem CID | 168812981 |
| Molecular Formula | C26H35FN4O2S |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 4-[(2R)-4-cyclobutylsulfonyl-1-(2-methylpropyl)piperazin-2-yl]-N-(4-fluorophenyl)-2-methanimidoyl-5-methylaniline |
| SMILES | [H]/N=C/c1cc([C@@H]2CN(S(=O)(=O)C3CCC3)CCN2CC(C)C)c(C)cc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H35FN4O2S/c1-18(2)16-30-11-12-31(34(32,33)23-5-4-6-23)17-26(30)24-14-20(15-28)25(13-19(24)3)29-22-9-7-21(27)8-10-22/h7-10,13-15,18,23,26,28-29H,4-6,11-12,16-17H2,1-3H3/b28-15+/t26-/m0/s1 |
| InChIKey | PQLKMQXSAVHKBP-CMCQIJKVSA-N |
| XLogP | 5.07 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|