C26H32F3N7S — CID 168961638
4-[1-(3,3-difluoro-2-methylbutyl)-4-(2-methyltriazol-4-yl)sulfanylpiperazin-2-yl]-N-(4-fluorophenyl)-2-methanimidoyl-5-methylaniline (PubChem CID 168961638) has the molecular formula C26H32F3N7S and a molecular weight of 531.65 g/mol. Its IUPAC name is 4-[1-(3,3-difluoro-2-methylbutyl)-4-(2-methyltriazol-4-yl)sulfanylpiperazin-2-yl]-N-(4-fluorophenyl)-2-methanimidoyl-5-methylaniline.
| Compound Name | 4-[1-(3,3-difluoro-2-methylbutyl)-4-(2-methyltriazol-4-yl)sulfanylpiperazin-2-yl]-N-(4-fluorophenyl)-2-methanimidoyl-5-methylaniline |
|---|---|
| PubChem CID | 168961638 |
| Molecular Formula | C26H32F3N7S |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | 4-[1-(3,3-difluoro-2-methylbutyl)-4-(2-methyltriazol-4-yl)sulfanylpiperazin-2-yl]-N-(4-fluorophenyl)-2-methanimidoyl-5-methylaniline |
| SMILES | [H]/N=C/c1cc(C2CN(Sc3cnn(C)n3)CCN2CC(C)C(C)(F)F)c(C)cc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H32F3N7S/c1-17-11-23(32-21-7-5-20(27)6-8-21)19(13-30)12-22(17)24-16-36(37-25-14-31-34(4)33-25)10-9-35(24)15-18(2)26(3,28)29/h5-8,11-14,18,24,30,32H,9-10,15-16H2,1-4H3/b30-13+ |
| InChIKey | LKYIOENHQMGXLY-VVEOGCPPSA-N |
| XLogP | 5.66 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|