C25H26F4N6S — CID 168961561
N-(4-fluorophenyl)-2-methanimidoyl-5-methyl-4-[4-pyridazin-3-ylsulfanyl-1-(3,3,3-trifluoropropyl)piperazin-2-yl]aniline (PubChem CID 168961561) has the molecular formula C25H26F4N6S and a molecular weight of 518.58 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-methanimidoyl-5-methyl-4-[4-pyridazin-3-ylsulfanyl-1-(3,3,3-trifluoropropyl)piperazin-2-yl]aniline.
| Compound Name | N-(4-fluorophenyl)-2-methanimidoyl-5-methyl-4-[4-pyridazin-3-ylsulfanyl-1-(3,3,3-trifluoropropyl)piperazin-2-yl]aniline |
|---|---|
| PubChem CID | 168961561 |
| Molecular Formula | C25H26F4N6S |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | N-(4-fluorophenyl)-2-methanimidoyl-5-methyl-4-[4-pyridazin-3-ylsulfanyl-1-(3,3,3-trifluoropropyl)piperazin-2-yl]aniline |
| SMILES | [H]/N=C/c1cc(C2CN(Sc3cccnn3)CCN2CCC(F)(F)F)c(C)cc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C25H26F4N6S/c1-17-13-22(32-20-6-4-19(26)5-7-20)18(15-30)14-21(17)23-16-35(36-24-3-2-9-31-33-24)12-11-34(23)10-8-25(27,28)29/h2-7,9,13-15,23,30,32H,8,10-12,16H2,1H3/b30-15+ |
| InChIKey | VBFDGSUFMPGNNR-FJEPWZHXSA-N |
| XLogP | 5.98 |
| TPSA | 68.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|