C23H25FN6OS — CID 168961339
[1-[4-(4-fluoroanilino)-5-methanimidoyl-2-methylphenyl]-3-(2-methyltriazol-4-yl)sulfanyl-3-azabicyclo[3.1.0]hexan-6-yl]methanol (PubChem CID 168961339) has the molecular formula C23H25FN6OS and a molecular weight of 452.56 g/mol. Its IUPAC name is [1-[4-(4-fluoroanilino)-5-methanimidoyl-2-methylphenyl]-3-(2-methyltriazol-4-yl)sulfanyl-3-azabicyclo[3.1.0]hexan-6-yl]methanol.
| Compound Name | [1-[4-(4-fluoroanilino)-5-methanimidoyl-2-methylphenyl]-3-(2-methyltriazol-4-yl)sulfanyl-3-azabicyclo[3.1.0]hexan-6-yl]methanol |
|---|---|
| PubChem CID | 168961339 |
| Molecular Formula | C23H25FN6OS |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | [1-[4-(4-fluoroanilino)-5-methanimidoyl-2-methylphenyl]-3-(2-methyltriazol-4-yl)sulfanyl-3-azabicyclo[3.1.0]hexan-6-yl]methanol |
| SMILES | [H]/N=C/c1cc(C23CN(Sc4cnn(C)n4)CC2C3CO)c(C)cc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C23H25FN6OS/c1-14-7-21(27-17-5-3-16(24)4-6-17)15(9-25)8-18(14)23-13-30(11-19(23)20(23)12-31)32-22-10-26-29(2)28-22/h3-10,19-20,25,27,31H,11-13H2,1-2H3/b25-9+ |
| InChIKey | QSXNNGIFVIOCPV-YCPBAFNGSA-N |
| XLogP | 3.50 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|