C28H31FN4O — CID 168960955
N-(4-fluorophenyl)-2-methanimidoyl-5-methyl-4-(3-methyl-6-phenyl-3-azabicyclo[3.1.0]hexan-1-yl)aniline;N-methylformamide (PubChem CID 168960955) has the molecular formula C28H31FN4O and a molecular weight of 458.58 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-methanimidoyl-5-methyl-4-(3-methyl-6-phenyl-3-azabicyclo[3.1.0]hexan-1-yl)aniline;N-methylformamide.
| Compound Name | N-(4-fluorophenyl)-2-methanimidoyl-5-methyl-4-(3-methyl-6-phenyl-3-azabicyclo[3.1.0]hexan-1-yl)aniline;N-methylformamide |
|---|---|
| PubChem CID | 168960955 |
| Molecular Formula | C28H31FN4O |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | N-(4-fluorophenyl)-2-methanimidoyl-5-methyl-4-(3-methyl-6-phenyl-3-azabicyclo[3.1.0]hexan-1-yl)aniline;N-methylformamide |
| SMILES | CNC=O.[H]/N=C/c1cc(C23CN(C)CC2C3c2ccccc2)c(C)cc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H26FN3.C2H5NO/c1-17-12-24(29-21-10-8-20(27)9-11-21)19(14-28)13-22(17)26-16-30(2)15-23(26)25(26)18-6-4-3-5-7-18;1-3-2-4/h3-14,23,25,28-29H,15-16H2,1-2H3;2H,1H3,(H,3,4)/b28-14+; |
| InChIKey | MOXXSLNYBWTVGG-KVQMOARXSA-N |
| XLogP | 4.83 |
| TPSA | 68.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|