C25H26FN3 — CID 155744235
4-[(2S)-4,4-dimethyl-2-phenylpyrrolidin-1-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline (PubChem CID 155744235) has the molecular formula C25H26FN3 and a molecular weight of 387.50 g/mol. Its IUPAC name is 4-[(2S)-4,4-dimethyl-2-phenylpyrrolidin-1-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline.
| Compound Name | 4-[(2S)-4,4-dimethyl-2-phenylpyrrolidin-1-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline |
|---|---|
| PubChem CID | 155744235 |
| Molecular Formula | C25H26FN3 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 4-[(2S)-4,4-dimethyl-2-phenylpyrrolidin-1-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline |
| SMILES | [H]/N=C/c1cc(N2CC(C)(C)C[C@H]2c2ccccc2)ccc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C25H26FN3/c1-25(2)15-24(18-6-4-3-5-7-18)29(17-25)22-12-13-23(19(14-22)16-27)28-21-10-8-20(26)9-11-21/h3-14,16,24,27-28H,15,17H2,1-2H3/b27-16+/t24-/m0/s1 |
| InChIKey | UXLBHLHBABCIPC-RLWVUDJFSA-N |
| XLogP | 6.54 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|