About 4-[(2S)-4,4-dimethyl-2-phenylpyrrolidin-1-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline
4-[(2S)-4,4-dimethyl-2-phenylpyrrolidin-1-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline (PubChem CID 155744235) has the molecular formula C25H26FN3
and a molecular weight of 387.50 g/mol. Its IUPAC name is 4-[(2S)-4,4-dimethyl-2-phenylpyrrolidin-1-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline.
Molecular Properties
| Compound Name | 4-[(2S)-4,4-dimethyl-2-phenylpyrrolidin-1-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline |
| PubChem CID | 155744235 |
| Molecular Formula | C25H26FN3 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 4-[(2S)-4,4-dimethyl-2-phenylpyrrolidin-1-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline |
| SMILES | [H]/N=C/c1cc(N2CC(C)(C)C[C@H]2c2ccccc2)ccc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C25H26FN3/c1-25(2)15-24(18-6-4-3-5-7-18)29(17-25)22-12-13-23(19(14-22)16-27)28-21-10-8-20(26)9-11-21/h3-14,16,24,27-28H,15,17H2,1-2H3/b27-16+/t24-/m0/s1 |
| InChIKey | UXLBHLHBABCIPC-RLWVUDJFSA-N |
| XLogP | 6.54 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2S)-4,4-dimethyl-2-phenylpyrrolidin-1-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2S)-4,4-dimethyl-2-phenylpyrrolidin-1-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline?
The IUPAC name of 4-[(2S)-4,4-dimethyl-2-phenylpyrrolidin-1-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline (CID 155744235) is 4-[(2S)-4,4-dimethyl-2-phenylpyrrolidin-1-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline.
What is the SMILES notation for 4-[(2S)-4,4-dimethyl-2-phenylpyrrolidin-1-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline?
The canonical SMILES for 4-[(2S)-4,4-dimethyl-2-phenylpyrrolidin-1-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline is [H]/N=C/c1cc(N2CC(C)(C)C[C@H]2c2ccccc2)ccc1Nc1ccc(F)cc1.
What is the InChIKey of 4-[(2S)-4,4-dimethyl-2-phenylpyrrolidin-1-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline?
The InChIKey is UXLBHLHBABCIPC-RLWVUDJFSA-N. The full InChI is InChI=1S/C25H26FN3/c1-25(2)15-24(18-6-4-3-5-7-18)29(17-25)22-12-13-23(19(14-22)16-27)28-21-10-8-20(26)9-11-21/h3-14,16,24,27-28H,15,17H2,1-2H3/b27-16+/t24-/m0/s1.
What are the key properties of 4-[(2S)-4,4-dimethyl-2-phenylpyrrolidin-1-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline?
4-[(2S)-4,4-dimethyl-2-phenylpyrrolidin-1-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline has a molecular weight of 387.50 g/mol, XLogP of 6.54, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2S)-4,4-dimethyl-2-phenylpyrrolidin-1-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline is sourced from PubChem (CID 155744235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).