C26H27FN4O — CID 166916302
1-[(2R)-2-benzyl-4-[4-(4-fluoroanilino)-3-methanimidoylphenyl]piperazin-1-yl]ethanone (PubChem CID 166916302) has the molecular formula C26H27FN4O and a molecular weight of 430.53 g/mol. Its IUPAC name is 1-[(2R)-2-benzyl-4-[4-(4-fluoroanilino)-3-methanimidoylphenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[(2R)-2-benzyl-4-[4-(4-fluoroanilino)-3-methanimidoylphenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 166916302 |
| Molecular Formula | C26H27FN4O |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 1-[(2R)-2-benzyl-4-[4-(4-fluoroanilino)-3-methanimidoylphenyl]piperazin-1-yl]ethanone |
| SMILES | [H]/N=C/c1cc(N2CCN(C(C)=O)[C@H](Cc3ccccc3)C2)ccc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H27FN4O/c1-19(32)31-14-13-30(18-25(31)15-20-5-3-2-4-6-20)24-11-12-26(21(16-24)17-28)29-23-9-7-22(27)8-10-23/h2-12,16-17,25,28-29H,13-15,18H2,1H3/b28-17+/t25-/m1/s1 |
| InChIKey | BTQWBJXSWHJWET-GLYRRZRCSA-N |
| XLogP | 4.85 |
| TPSA | 59.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|