C30H34FN3O2 — CID 89276485
3-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-N-(2-hydroxycyclopentyl)-2,2-dimethyl-4-phenylbutanamide (PubChem CID 89276485) has the molecular formula C30H34FN3O2 and a molecular weight of 487.62 g/mol. Its IUPAC name is 3-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-N-(2-hydroxycyclopentyl)-2,2-dimethyl-4-phenylbutanamide.
| Compound Name | 3-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-N-(2-hydroxycyclopentyl)-2,2-dimethyl-4-phenylbutanamide |
|---|---|
| PubChem CID | 89276485 |
| Molecular Formula | C30H34FN3O2 |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 3-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-N-(2-hydroxycyclopentyl)-2,2-dimethyl-4-phenylbutanamide |
| SMILES | [H]/N=C/c1cc(C(Cc2ccccc2)C(C)(C)C(=O)NC2CCCC2O)ccc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C30H34FN3O2/c1-30(2,29(36)34-27-9-6-10-28(27)35)25(17-20-7-4-3-5-8-20)21-11-16-26(22(18-21)19-32)33-24-14-12-23(31)13-15-24/h3-5,7-8,11-16,18-19,25,27-28,32-33,35H,6,9-10,17H2,1-2H3,(H,34,36)/b32-19+ |
| InChIKey | VRZYTWXKDHLBMX-BIZUNTBRSA-N |
| XLogP | 5.95 |
| TPSA | 85.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|