C24H26FN3 — CID 143670957
4-(3-amino-2,2-dimethyl-1-phenylpropyl)-N-(4-fluorophenyl)-2-methanimidoylaniline (PubChem CID 143670957) has the molecular formula C24H26FN3 and a molecular weight of 375.49 g/mol. Its IUPAC name is 4-(3-amino-2,2-dimethyl-1-phenylpropyl)-N-(4-fluorophenyl)-2-methanimidoylaniline.
| Compound Name | 4-(3-amino-2,2-dimethyl-1-phenylpropyl)-N-(4-fluorophenyl)-2-methanimidoylaniline |
|---|---|
| PubChem CID | 143670957 |
| Molecular Formula | C24H26FN3 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 4-(3-amino-2,2-dimethyl-1-phenylpropyl)-N-(4-fluorophenyl)-2-methanimidoylaniline |
| SMILES | [H]/N=C/c1cc(C(c2ccccc2)C(C)(C)CN)ccc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H26FN3/c1-24(2,16-27)23(17-6-4-3-5-7-17)18-8-13-22(19(14-18)15-26)28-21-11-9-20(25)10-12-21/h3-15,23,26,28H,16,27H2,1-2H3/b26-15+ |
| InChIKey | PUGXVLAZGJOMIK-CVKSISIWSA-N |
| XLogP | 5.68 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|