C18H19FN2 — CID 144586602
5-ethyl-N-(4-fluorophenyl)-2-methanimidoyl-4-prop-1-en-2-ylaniline (PubChem CID 144586602) has the molecular formula C18H19FN2 and a molecular weight of 282.36 g/mol. Its IUPAC name is 5-ethyl-N-(4-fluorophenyl)-2-methanimidoyl-4-prop-1-en-2-ylaniline.
| Compound Name | 5-ethyl-N-(4-fluorophenyl)-2-methanimidoyl-4-prop-1-en-2-ylaniline |
|---|---|
| PubChem CID | 144586602 |
| Molecular Formula | C18H19FN2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 5-ethyl-N-(4-fluorophenyl)-2-methanimidoyl-4-prop-1-en-2-ylaniline |
| SMILES | [H]/N=C/c1cc(C(=C)C)c(CC)cc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H19FN2/c1-4-13-10-18(14(11-20)9-17(13)12(2)3)21-16-7-5-15(19)6-8-16/h5-11,20-21H,2,4H2,1,3H3/b20-11+ |
| InChIKey | UAPMEMPLGCNSRY-RGVLZGJSSA-N |
| XLogP | 5.16 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|