C28H40FN3O — CID 59251112
N-[3-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-2,2,5-trimethylhexyl]-3,3-dimethylbutanamide (PubChem CID 59251112) has the molecular formula C28H40FN3O and a molecular weight of 453.65 g/mol. Its IUPAC name is N-[3-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-2,2,5-trimethylhexyl]-3,3-dimethylbutanamide.
| Compound Name | N-[3-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-2,2,5-trimethylhexyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 59251112 |
| Molecular Formula | C28H40FN3O |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.32 |
| IUPAC Name | N-[3-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-2,2,5-trimethylhexyl]-3,3-dimethylbutanamide |
| SMILES | [H]/N=C/c1cc(C(CC(C)C)C(C)(C)CNC(=O)CC(C)(C)C)ccc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C28H40FN3O/c1-19(2)14-24(28(6,7)18-31-26(33)16-27(3,4)5)20-8-13-25(21(15-20)17-30)32-23-11-9-22(29)10-12-23/h8-13,15,17,19,24,30,32H,14,16,18H2,1-7H3,(H,31,33)/b30-17+ |
| InChIKey | UGKUGKNYOBRZDD-OCSSWDANSA-N |
| XLogP | 7.28 |
| TPSA | 64.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|