C26H39FN4O2S — CID 59251078
4-[1-(tert-butylsulfamoylamino)-2,2,5-trimethylhexan-3-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline (PubChem CID 59251078) has the molecular formula C26H39FN4O2S and a molecular weight of 490.69 g/mol. Its IUPAC name is 4-[1-(tert-butylsulfamoylamino)-2,2,5-trimethylhexan-3-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline.
| Compound Name | 4-[1-(tert-butylsulfamoylamino)-2,2,5-trimethylhexan-3-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline |
|---|---|
| PubChem CID | 59251078 |
| Molecular Formula | C26H39FN4O2S |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 4-[1-(tert-butylsulfamoylamino)-2,2,5-trimethylhexan-3-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline |
| SMILES | [H]/N=C/c1cc(C(CC(C)C)C(C)(C)CNS(=O)(=O)NC(C)(C)C)ccc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H39FN4O2S/c1-18(2)14-23(26(6,7)17-29-34(32,33)31-25(3,4)5)19-8-13-24(20(15-19)16-28)30-22-11-9-21(27)10-12-22/h8-13,15-16,18,23,28-31H,14,17H2,1-7H3/b28-16+ |
| InChIKey | MQHAMGLXXXCAOB-LQKURTRISA-N |
| XLogP | 5.95 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|