About 4-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-3,3-dimethyl-1,4-diphenylbutan-2-ol
4-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-3,3-dimethyl-1,4-diphenylbutan-2-ol (PubChem CID 59251174) has the molecular formula C31H31FN2O
and a molecular weight of 466.60 g/mol. Its IUPAC name is 4-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-3,3-dimethyl-1,4-diphenylbutan-2-ol.
Molecular Properties
| Compound Name | 4-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-3,3-dimethyl-1,4-diphenylbutan-2-ol |
| PubChem CID | 59251174 |
| Molecular Formula | C31H31FN2O |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 4-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-3,3-dimethyl-1,4-diphenylbutan-2-ol |
| SMILES | [H]/N=C/c1cc(C(c2ccccc2)C(C)(C)C(O)Cc2ccccc2)ccc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C31H31FN2O/c1-31(2,29(35)19-22-9-5-3-6-10-22)30(23-11-7-4-8-12-23)24-13-18-28(25(20-24)21-33)34-27-16-14-26(32)15-17-27/h3-18,20-21,29-30,33-35H,19H2,1-2H3/b33-21+ |
| InChIKey | YBKMHEHFFLPIMA-QNKGDIEWSA-N |
| XLogP | 7.33 |
| TPSA | 56.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-3,3-dimethyl-1,4-diphenylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-3,3-dimethyl-1,4-diphenylbutan-2-ol?
The IUPAC name of 4-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-3,3-dimethyl-1,4-diphenylbutan-2-ol (CID 59251174) is 4-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-3,3-dimethyl-1,4-diphenylbutan-2-ol.
What is the SMILES notation for 4-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-3,3-dimethyl-1,4-diphenylbutan-2-ol?
The canonical SMILES for 4-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-3,3-dimethyl-1,4-diphenylbutan-2-ol is [H]/N=C/c1cc(C(c2ccccc2)C(C)(C)C(O)Cc2ccccc2)ccc1Nc1ccc(F)cc1.
What is the InChIKey of 4-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-3,3-dimethyl-1,4-diphenylbutan-2-ol?
The InChIKey is YBKMHEHFFLPIMA-QNKGDIEWSA-N. The full InChI is InChI=1S/C31H31FN2O/c1-31(2,29(35)19-22-9-5-3-6-10-22)30(23-11-7-4-8-12-23)24-13-18-28(25(20-24)21-33)34-27-16-14-26(32)15-17-27/h3-18,20-21,29-30,33-35H,19H2,1-2H3/b33-21+.
What are the key properties of 4-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-3,3-dimethyl-1,4-diphenylbutan-2-ol?
4-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-3,3-dimethyl-1,4-diphenylbutan-2-ol has a molecular weight of 466.60 g/mol, XLogP of 7.33, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-3,3-dimethyl-1,4-diphenylbutan-2-ol is sourced from PubChem (CID 59251174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).