C26H30FN3O2S — CID 143670961
N-[(3S)-3-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-2,2-dimethyl-3-phenylpropyl]ethanesulfonamide (PubChem CID 143670961) has the molecular formula C26H30FN3O2S and a molecular weight of 467.61 g/mol. Its IUPAC name is N-[(3S)-3-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-2,2-dimethyl-3-phenylpropyl]ethanesulfonamide.
| Compound Name | N-[(3S)-3-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-2,2-dimethyl-3-phenylpropyl]ethanesulfonamide |
|---|---|
| PubChem CID | 143670961 |
| Molecular Formula | C26H30FN3O2S |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | N-[(3S)-3-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-2,2-dimethyl-3-phenylpropyl]ethanesulfonamide |
| SMILES | [H]/N=C/c1cc([C@H](c2ccccc2)C(C)(C)CNS(=O)(=O)CC)ccc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H30FN3O2S/c1-4-33(31,32)29-18-26(2,3)25(19-8-6-5-7-9-19)20-10-15-24(21(16-20)17-28)30-23-13-11-22(27)12-14-23/h5-17,25,28-30H,4,18H2,1-3H3/b28-17+/t25-/m0/s1 |
| InChIKey | KNXIFRLNBBVVNO-ISAGNRBTSA-N |
| XLogP | 5.66 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|