C33H42FN5O2 — CID 59251179
2-[[3-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-2,2,5-trimethylhexyl]carbamoylamino]-2-methyl-N-phenylpropanamide (PubChem CID 59251179) has the molecular formula C33H42FN5O2 and a molecular weight of 559.73 g/mol. Its IUPAC name is 2-[[3-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-2,2,5-trimethylhexyl]carbamoylamino]-2-methyl-N-phenylpropanamide.
| Compound Name | 2-[[3-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-2,2,5-trimethylhexyl]carbamoylamino]-2-methyl-N-phenylpropanamide |
|---|---|
| PubChem CID | 59251179 |
| Molecular Formula | C33H42FN5O2 |
| Molecular Weight | 559.73 g/mol |
| Exact Mass | 559.33 |
| IUPAC Name | 2-[[3-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-2,2,5-trimethylhexyl]carbamoylamino]-2-methyl-N-phenylpropanamide |
| SMILES | [H]/N=C/c1cc(C(CC(C)C)C(C)(C)CNC(=O)NC(C)(C)C(=O)Nc2ccccc2)ccc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C33H42FN5O2/c1-22(2)18-28(23-12-17-29(24(19-23)20-35)37-27-15-13-25(34)14-16-27)32(3,4)21-36-31(41)39-33(5,6)30(40)38-26-10-8-7-9-11-26/h7-17,19-20,22,28,35,37H,18,21H2,1-6H3,(H,38,40)(H2,36,39,41)/b35-20+ |
| InChIKey | WVRJAEDPDSCRJM-JEPNHJGPSA-N |
| XLogP | 7.44 |
| TPSA | 106.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.73 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|