C30H30FN3OS — CID 59251134
N-[(3R)-3-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-2,2-dimethyl-3-phenylpropyl]-2-thiophen-2-ylacetamide (PubChem CID 59251134) has the molecular formula C30H30FN3OS and a molecular weight of 499.66 g/mol. Its IUPAC name is N-[(3R)-3-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-2,2-dimethyl-3-phenylpropyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(3R)-3-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-2,2-dimethyl-3-phenylpropyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 59251134 |
| Molecular Formula | C30H30FN3OS |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | N-[(3R)-3-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-2,2-dimethyl-3-phenylpropyl]-2-thiophen-2-ylacetamide |
| SMILES | [H]/N=C/c1cc([C@@H](c2ccccc2)C(C)(C)CNC(=O)Cc2cccs2)ccc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C30H30FN3OS/c1-30(2,20-33-28(35)18-26-9-6-16-36-26)29(21-7-4-3-5-8-21)22-10-15-27(23(17-22)19-32)34-25-13-11-24(31)12-14-25/h3-17,19,29,32,34H,18,20H2,1-2H3,(H,33,35)/b32-19+/t29-/m1/s1 |
| InChIKey | CZRNKXIWBWHGIC-RWGCQLDOSA-N |
| XLogP | 7.15 |
| TPSA | 64.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|