C25H25FN4O — CID 168961533
1-benzyl-6-[4-(4-fluoroanilino)-5-methanimidoyl-2-methylphenyl]piperazin-2-one (PubChem CID 168961533) has the molecular formula C25H25FN4O and a molecular weight of 416.50 g/mol. Its IUPAC name is 1-benzyl-6-[4-(4-fluoroanilino)-5-methanimidoyl-2-methylphenyl]piperazin-2-one.
| Compound Name | 1-benzyl-6-[4-(4-fluoroanilino)-5-methanimidoyl-2-methylphenyl]piperazin-2-one |
|---|---|
| PubChem CID | 168961533 |
| Molecular Formula | C25H25FN4O |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 1-benzyl-6-[4-(4-fluoroanilino)-5-methanimidoyl-2-methylphenyl]piperazin-2-one |
| SMILES | [H]/N=C/c1cc(C2CNCC(=O)N2Cc2ccccc2)c(C)cc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C25H25FN4O/c1-17-11-23(29-21-9-7-20(26)8-10-21)19(13-27)12-22(17)24-14-28-15-25(31)30(24)16-18-5-3-2-4-6-18/h2-13,24,27-29H,14-16H2,1H3/b27-13+ |
| InChIKey | XXJQRPBBNRHNNG-UVHMKAGCSA-N |
| XLogP | 4.55 |
| TPSA | 68.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|