C24H27F4N7O2S — CID 168813197
N-[(Z)-[2-[(3S)-3-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-4-(3,3,3-trifluoropropyl)piperazin-1-yl]sulfonyl-2-iminoethylidene]amino]methanamine (PubChem CID 168813197) has the molecular formula C24H27F4N7O2S and a molecular weight of 553.59 g/mol. Its IUPAC name is N-[(Z)-[2-[(3S)-3-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-4-(3,3,3-trifluoropropyl)piperazin-1-yl]sulfonyl-2-iminoethylidene]amino]methanamine.
| Compound Name | N-[(Z)-[2-[(3S)-3-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-4-(3,3,3-trifluoropropyl)piperazin-1-yl]sulfonyl-2-iminoethylidene]amino]methanamine |
|---|---|
| PubChem CID | 168813197 |
| Molecular Formula | C24H27F4N7O2S |
| Molecular Weight | 553.59 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | N-[(Z)-[2-[(3S)-3-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-4-(3,3,3-trifluoropropyl)piperazin-1-yl]sulfonyl-2-iminoethylidene]amino]methanamine |
| SMILES | [H]/N=C(\C=N/NC)S(=O)(=O)N1CCN(CCC(F)(F)F)[C@@H](c2cc3cnn(-c4ccc(F)cc4)c3cc2C)C1 |
| InChI | InChI=1S/C24H27F4N7O2S/c1-16-11-21-17(13-32-35(21)19-5-3-18(25)4-6-19)12-20(16)22-15-34(38(36,37)23(29)14-31-30-2)10-9-33(22)8-7-24(26,27)28/h3-6,11-14,22,29-30H,7-10,15H2,1-2H3/b29-23+,31-14-/t22-/m1/s1 |
| InChIKey | GAOWRAOYVOFJIS-CMKWGLGGSA-N |
| XLogP | 3.60 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.59 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|