C54H42N2OS — CID 168814800
N-[4-(1,6,7,9b-tetrahydrodibenzofuran-1-yl)cyclohexa-2,4-dien-1-yl]-N-[4-(9-phenylcarbazol-2-yl)phenyl]-2,3-dihydrodibenzothiophen-1-amine (PubChem CID 168814800) has the molecular formula C54H42N2OS and a molecular weight of 767.01 g/mol. Its IUPAC name is N-[4-(1,6,7,9b-tetrahydrodibenzofuran-1-yl)cyclohexa-2,4-dien-1-yl]-N-[4-(9-phenylcarbazol-2-yl)phenyl]-2,3-dihydrodibenzothiophen-1-amine.
| Compound Name | N-[4-(1,6,7,9b-tetrahydrodibenzofuran-1-yl)cyclohexa-2,4-dien-1-yl]-N-[4-(9-phenylcarbazol-2-yl)phenyl]-2,3-dihydrodibenzothiophen-1-amine |
|---|---|
| PubChem CID | 168814800 |
| Molecular Formula | C54H42N2OS |
| Molecular Weight | 767.01 g/mol |
| Exact Mass | 766.30 |
| IUPAC Name | N-[4-(1,6,7,9b-tetrahydrodibenzofuran-1-yl)cyclohexa-2,4-dien-1-yl]-N-[4-(9-phenylcarbazol-2-yl)phenyl]-2,3-dihydrodibenzothiophen-1-amine |
| SMILES | C1=CC(C2=CCC(N(C3=c4c(sc5ccccc45)=CCC3)c3ccc(-c4ccc5c6ccccc6n(-c6ccccc6)c5c4)cc3)C=C2)C2C(=C1)OC1=C2C=CCC1 |
| InChI | InChI=1S/C54H42N2OS/c1-2-12-38(13-3-1)56-46-18-7-4-14-42(46)43-33-28-37(34-48(43)56)35-24-29-39(30-25-35)55(47-19-11-23-52-54(47)45-16-6-9-22-51(45)58-52)40-31-26-36(27-32-40)41-17-10-21-50-53(41)44-15-5-8-20-49(44)57-50/h1-7,9-10,12-18,21-31,33-34,40-41,53H,8,11,19-20,32H2 |
| InChIKey | MPTFVEQNQLAQKP-UHFFFAOYSA-N |
| XLogP | 12.43 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.01 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |