C46H52 — CID 168815364
12',12'-dimethyl-1,2,3,25'-tetra(propan-2-yl)spiro[cyclohexene-5,17'-heptacyclo[14.11.0.02,13.03,11.05,10.018,27.019,24]heptacosa-1(16),2(13),3(11),5,7,9,14,18(27),19,21,23,25-dodecaene] (PubChem CID 168815364) has the molecular formula C46H52 and a molecular weight of 604.92 g/mol. Its IUPAC name is 12',12'-dimethyl-1,2,3,25'-tetra(propan-2-yl)spiro[cyclohexene-5,17'-heptacyclo[14.11.0.02,13.03,11.05,10.018,27.019,24]heptacosa-1(16),2(13),3(11),5,7,9,14,18(27),19,21,23,25-dodecaene].
| Compound Name | 12',12'-dimethyl-1,2,3,25'-tetra(propan-2-yl)spiro[cyclohexene-5,17'-heptacyclo[14.11.0.02,13.03,11.05,10.018,27.019,24]heptacosa-1(16),2(13),3(11),5,7,9,14,18(27),19,21,23,25-dodecaene] |
|---|---|
| PubChem CID | 168815364 |
| Molecular Formula | C46H52 |
| Molecular Weight | 604.92 g/mol |
| Exact Mass | 604.41 |
| IUPAC Name | 12',12'-dimethyl-1,2,3,25'-tetra(propan-2-yl)spiro[cyclohexene-5,17'-heptacyclo[14.11.0.02,13.03,11.05,10.018,27.019,24]heptacosa-1(16),2(13),3(11),5,7,9,14,18(27),19,21,23,25-dodecaene] |
| SMILES | CC(C)C1=C(C(C)C)C(C(C)C)CC2(C1)c1ccc3c(c1-c1cc(C(C)C)c4ccccc4c12)C1=C(c2ccccc2C1)C3(C)C |
| InChI | InChI=1S/C46H52/c1-25(2)33-22-35-42-39(20-19-38-41(42)34-21-29-15-11-12-16-30(29)43(34)45(38,9)10)46(44(35)32-18-14-13-17-31(32)33)23-36(26(3)4)40(28(7)8)37(24-46)27(5)6/h11-20,22,25-28,36H,21,23-24H2,1-10H3 |
| InChIKey | GLRZBGHGPRGSGL-UHFFFAOYSA-N |
| XLogP | 12.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.92 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|