C39H41IrN2O2S- — CID 168816554
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4,6-dimethyl-15-(3H-naphthalen-3-id-2-yl)-17-thia-12,14-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene;iridium (PubChem CID 168816554) has the molecular formula C39H41IrN2O2S- and a molecular weight of 794.05 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4,6-dimethyl-15-(3H-naphthalen-3-id-2-yl)-17-thia-12,14-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene;iridium.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4,6-dimethyl-15-(3H-naphthalen-3-id-2-yl)-17-thia-12,14-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene;iridium |
|---|---|
| PubChem CID | 168816554 |
| Molecular Formula | C39H41IrN2O2S- |
| Molecular Weight | 794.05 g/mol |
| Exact Mass | 794.25 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4,6-dimethyl-15-(3H-naphthalen-3-id-2-yl)-17-thia-12,14-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1cc(C)c2ccc3c4ncnc(-c5[c-]cc6ccccc6c5)c4sc3c2c1.[Ir] |
| InChI | InChI=1S/C26H17N2S.C13H24O2.Ir/c1-15-11-16(2)20-9-10-21-24-26(29-25(21)22(20)12-15)23(27-14-28-24)19-8-7-17-5-3-4-6-18(17)13-19;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h3-7,9-14H,1-2H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | PKESMKQPCRPSOI-DZTQYQPZSA-N |
| XLogP | 11.10 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.05 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|