C25H31N3 — CID 168820008
N-tert-butyl-1,3-bis[(E)-3-phenylprop-2-enyl]imidazolidin-2-imine (PubChem CID 168820008) has the molecular formula C25H31N3 and a molecular weight of 373.54 g/mol. Its IUPAC name is N-tert-butyl-1,3-bis[(E)-3-phenylprop-2-enyl]imidazolidin-2-imine.
| Compound Name | N-tert-butyl-1,3-bis[(E)-3-phenylprop-2-enyl]imidazolidin-2-imine |
|---|---|
| PubChem CID | 168820008 |
| Molecular Formula | C25H31N3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | N-tert-butyl-1,3-bis[(E)-3-phenylprop-2-enyl]imidazolidin-2-imine |
| SMILES | CC(C)(C)N=C1N(C/C=C/c2ccccc2)CCN1C/C=C/c1ccccc1 |
| InChI | InChI=1S/C25H31N3/c1-25(2,3)26-24-27(18-10-16-22-12-6-4-7-13-22)20-21-28(24)19-11-17-23-14-8-5-9-15-23/h4-17H,18-21H2,1-3H3/b16-10+,17-11+ |
| InChIKey | AOAGXTDNPRUYAC-OTYYAQKOSA-N |
| XLogP | 5.19 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|