C10H20O — CID 168820123
cis-(1S,5R)-2-methyl-5-propan-2-ylcyclohexan-1-ol (PubChem CID 168820123) has the molecular formula C10H20O and a molecular weight of 156.27 g/mol. Its IUPAC name is cis-(1S,5R)-2-methyl-5-propan-2-ylcyclohexan-1-ol.
| Compound Name | cis-(1S,5R)-2-methyl-5-propan-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 168820123 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | cis-(1S,5R)-2-methyl-5-propan-2-ylcyclohexan-1-ol |
| SMILES | CC(C)[C@@H]1CCC(C)[C@@H](O)C1 |
| InChI | InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)10(11)6-9/h7-11H,4-6H2,1-3H3/t8?,9-,10+/m1/s1 |
| InChIKey | ULJXKUJMXIVDOY-XVBQNVSMSA-N |
| XLogP | 2.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |