C29H21FIrN2-2 — CID 168823000
2-(3-fluorobenzene-2-id-1-yl)-5-(trideuteriomethyl)pyridine;iridium;5-phenyl-2-phenylpyridine (PubChem CID 168823000) has the molecular formula C29H21FIrN2-2 and a molecular weight of 611.73 g/mol. Its IUPAC name is 2-(3-fluorobenzene-2-id-1-yl)-5-(trideuteriomethyl)pyridine;iridium;5-phenyl-2-phenylpyridine.
| Compound Name | 2-(3-fluorobenzene-2-id-1-yl)-5-(trideuteriomethyl)pyridine;iridium;5-phenyl-2-phenylpyridine |
|---|---|
| PubChem CID | 168823000 |
| Molecular Formula | C29H21FIrN2-2 |
| Molecular Weight | 611.73 g/mol |
| Exact Mass | 612.15 |
| IUPAC Name | 2-(3-fluorobenzene-2-id-1-yl)-5-(trideuteriomethyl)pyridine;iridium;5-phenyl-2-phenylpyridine |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2[c-]c(F)ccc2)nc1.[Ir].[c-]1ccccc1-c1ccc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C17H12N.C12H9FN.Ir/c1-3-7-14(8-4-1)16-11-12-17(18-13-16)15-9-5-2-6-10-15;1-9-5-6-12(14-8-9)10-3-2-4-11(13)7-10;/h1-9,11-13H;2-6,8H,1H3;/q2*-1;/i;1D3; |
| InChIKey | PNWZHLOSEVMOLA-ICMJTWPQSA-N |
| XLogP | 7.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.73 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|