C44H44N2O2 — CID 168823273
5,12-bis(3,5-dimethylphenyl)-2,3,9,10-tetraethylquinolino[2,3-b]acridine-7,14-dione (PubChem CID 168823273) has the molecular formula C44H44N2O2 and a molecular weight of 632.85 g/mol. Its IUPAC name is 5,12-bis(3,5-dimethylphenyl)-2,3,9,10-tetraethylquinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 5,12-bis(3,5-dimethylphenyl)-2,3,9,10-tetraethylquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 168823273 |
| Molecular Formula | C44H44N2O2 |
| Molecular Weight | 632.85 g/mol |
| Exact Mass | 632.34 |
| IUPAC Name | 5,12-bis(3,5-dimethylphenyl)-2,3,9,10-tetraethylquinolino[2,3-b]acridine-7,14-dione |
| SMILES | CCc1cc2c(=O)c3cc4c(cc3n(-c3cc(C)cc(C)c3)c2cc1CC)c(=O)c1cc(CC)c(CC)cc1n4-c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C44H44N2O2/c1-9-29-19-35-39(21-31(29)11-3)45(33-15-25(5)13-26(6)16-33)41-24-38-42(23-37(41)43(35)47)46(34-17-27(7)14-28(8)18-34)40-22-32(12-4)30(10-2)20-36(40)44(38)48/h13-24H,9-12H2,1-8H3 |
| InChIKey | SEUJSXBLKQVORZ-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.85 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|