C30H34N2O — CID 102491132
1-(3,5-dimethylphenyl)-7-(hexylamino)-2-(4-methylphenyl)quinolin-4-one (PubChem CID 102491132) has the molecular formula C30H34N2O and a molecular weight of 438.62 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-7-(hexylamino)-2-(4-methylphenyl)quinolin-4-one.
| Compound Name | 1-(3,5-dimethylphenyl)-7-(hexylamino)-2-(4-methylphenyl)quinolin-4-one |
|---|---|
| PubChem CID | 102491132 |
| Molecular Formula | C30H34N2O |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-7-(hexylamino)-2-(4-methylphenyl)quinolin-4-one |
| SMILES | CCCCCCNc1ccc2c(=O)cc(-c3ccc(C)cc3)n(-c3cc(C)cc(C)c3)c2c1 |
| InChI | InChI=1S/C30H34N2O/c1-5-6-7-8-15-31-25-13-14-27-29(19-25)32(26-17-22(3)16-23(4)18-26)28(20-30(27)33)24-11-9-21(2)10-12-24/h9-14,16-20,31H,5-8,15H2,1-4H3 |
| InChIKey | GPVDWKWBKGZTIW-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|