C16H11F3INO4 — CID 168825215
1-[6-iodo-4-[4-(trifluoromethoxy)phenyl]-1,3-benzoxazol-7-yl]ethane-1,2-diol (PubChem CID 168825215) has the molecular formula C16H11F3INO4 and a molecular weight of 465.17 g/mol. Its IUPAC name is 1-[6-iodo-4-[4-(trifluoromethoxy)phenyl]-1,3-benzoxazol-7-yl]ethane-1,2-diol.
| Compound Name | 1-[6-iodo-4-[4-(trifluoromethoxy)phenyl]-1,3-benzoxazol-7-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 168825215 |
| Molecular Formula | C16H11F3INO4 |
| Molecular Weight | 465.17 g/mol |
| Exact Mass | 464.97 |
| IUPAC Name | 1-[6-iodo-4-[4-(trifluoromethoxy)phenyl]-1,3-benzoxazol-7-yl]ethane-1,2-diol |
| SMILES | OCC(O)c1c(I)cc(-c2ccc(OC(F)(F)F)cc2)c2ncoc12 |
| InChI | InChI=1S/C16H11F3INO4/c17-16(18,19)25-9-3-1-8(2-4-9)10-5-11(20)13(12(23)6-22)15-14(10)21-7-24-15/h1-5,7,12,22-23H,6H2 |
| InChIKey | JGOLGYXNEZWTKI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.17 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|