C19H10F7NO2 — CID 118829246
2-fluoro-4,5-bis[4-(trifluoromethoxy)phenyl]pyridine (PubChem CID 118829246) has the molecular formula C19H10F7NO2 and a molecular weight of 417.28 g/mol. Its IUPAC name is 2-fluoro-4,5-bis[4-(trifluoromethoxy)phenyl]pyridine.
| Compound Name | 2-fluoro-4,5-bis[4-(trifluoromethoxy)phenyl]pyridine |
|---|---|
| PubChem CID | 118829246 |
| Molecular Formula | C19H10F7NO2 |
| Molecular Weight | 417.28 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 2-fluoro-4,5-bis[4-(trifluoromethoxy)phenyl]pyridine |
| SMILES | Fc1cc(-c2ccc(OC(F)(F)F)cc2)c(-c2ccc(OC(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C19H10F7NO2/c20-17-9-15(11-1-5-13(6-2-11)28-18(21,22)23)16(10-27-17)12-3-7-14(8-4-12)29-19(24,25)26/h1-10H |
| InChIKey | PCEOMGBYXJZFFX-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.28 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|