C18H9F6N2O3- — CID 143625455
4,5-bis[4-(trifluoromethoxy)phenyl]pyridazin-3-olate (PubChem CID 143625455) has the molecular formula C18H9F6N2O3- and a molecular weight of 415.27 g/mol. Its IUPAC name is 4,5-bis[4-(trifluoromethoxy)phenyl]pyridazin-3-olate.
| Compound Name | 4,5-bis[4-(trifluoromethoxy)phenyl]pyridazin-3-olate |
|---|---|
| PubChem CID | 143625455 |
| Molecular Formula | C18H9F6N2O3- |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 4,5-bis[4-(trifluoromethoxy)phenyl]pyridazin-3-olate |
| SMILES | [O-]c1nncc(-c2ccc(OC(F)(F)F)cc2)c1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H10F6N2O3/c19-17(20,21)28-12-5-1-10(2-6-12)14-9-25-26-16(27)15(14)11-3-7-13(8-4-11)29-18(22,23)24/h1-9H,(H,26,27)/p-1 |
| InChIKey | XXVGVDMEKUFMJH-UHFFFAOYSA-M |
| XLogP | 4.68 |
| TPSA | 67.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |