C12H5F6NO — CID 118809583
2,3,5-trifluoro-6-[4-(trifluoromethoxy)phenyl]pyridine (PubChem CID 118809583) has the molecular formula C12H5F6NO and a molecular weight of 293.17 g/mol. Its IUPAC name is 2,3,5-trifluoro-6-[4-(trifluoromethoxy)phenyl]pyridine.
| Compound Name | 2,3,5-trifluoro-6-[4-(trifluoromethoxy)phenyl]pyridine |
|---|---|
| PubChem CID | 118809583 |
| Molecular Formula | C12H5F6NO |
| Molecular Weight | 293.17 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 2,3,5-trifluoro-6-[4-(trifluoromethoxy)phenyl]pyridine |
| SMILES | Fc1cc(F)c(-c2ccc(OC(F)(F)F)cc2)nc1F |
| InChI | InChI=1S/C12H5F6NO/c13-8-5-9(14)11(15)19-10(8)6-1-3-7(4-2-6)20-12(16,17)18/h1-5H |
| InChIKey | WGAHSOSOIGSIRC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.17 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|