C53H34N8Si — CID 168826513
9-[4-(benzimidazolo[1,2-a]benzimidazol-5-yl)-6-(3-triphenylsilylphenyl)-1,3,5-triazin-2-yl]carbazole-3-carbonitrile (PubChem CID 168826513) has the molecular formula C53H34N8Si and a molecular weight of 811.00 g/mol. Its IUPAC name is 9-[4-(benzimidazolo[1,2-a]benzimidazol-5-yl)-6-(3-triphenylsilylphenyl)-1,3,5-triazin-2-yl]carbazole-3-carbonitrile.
| Compound Name | 9-[4-(benzimidazolo[1,2-a]benzimidazol-5-yl)-6-(3-triphenylsilylphenyl)-1,3,5-triazin-2-yl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 168826513 |
| Molecular Formula | C53H34N8Si |
| Molecular Weight | 811.00 g/mol |
| Exact Mass | 810.27 |
| IUPAC Name | 9-[4-(benzimidazolo[1,2-a]benzimidazol-5-yl)-6-(3-triphenylsilylphenyl)-1,3,5-triazin-2-yl]carbazole-3-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)c1ccccc1n2-c1nc(-c2cccc([Si](c3ccccc3)(c3ccccc3)c3ccccc3)c2)nc(-n2c3ccccc3n3c4ccccc4nc23)n1 |
| InChI | InChI=1S/C53H34N8Si/c54-35-36-31-32-46-43(33-36)42-25-10-12-27-45(42)59(46)51-56-50(57-52(58-51)61-49-30-15-14-29-48(49)60-47-28-13-11-26-44(47)55-53(60)61)37-17-16-24-41(34-37)62(38-18-4-1-5-19-38,39-20-6-2-7-21-39)40-22-8-3-9-23-40/h1-34H |
| InChIKey | IRXOLRPNXSJCDW-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 89.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.00 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|