C64H43N7Si — CID 168826577
[4-[4-(benzimidazolo[1,2-a]benzimidazol-5-yl)-6-(3,6-diphenylcarbazol-9-yl)-1,3,5-triazin-2-yl]phenyl]-triphenylsilane (PubChem CID 168826577) has the molecular formula C64H43N7Si and a molecular weight of 938.18 g/mol. Its IUPAC name is [4-[4-(benzimidazolo[1,2-a]benzimidazol-5-yl)-6-(3,6-diphenylcarbazol-9-yl)-1,3,5-triazin-2-yl]phenyl]-triphenylsilane.
| Compound Name | [4-[4-(benzimidazolo[1,2-a]benzimidazol-5-yl)-6-(3,6-diphenylcarbazol-9-yl)-1,3,5-triazin-2-yl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 168826577 |
| Molecular Formula | C64H43N7Si |
| Molecular Weight | 938.18 g/mol |
| Exact Mass | 937.33 |
| IUPAC Name | [4-[4-(benzimidazolo[1,2-a]benzimidazol-5-yl)-6-(3,6-diphenylcarbazol-9-yl)-1,3,5-triazin-2-yl]phenyl]-triphenylsilane |
| SMILES | c1ccc(-c2ccc3c(c2)c2cc(-c4ccccc4)ccc2n3-c2nc(-c3ccc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)cc3)nc(-n3c4ccccc4n4c5ccccc5nc34)n2)cc1 |
| InChI | InChI=1S/C64H43N7Si/c1-6-20-44(21-7-1)47-36-40-56-53(42-47)54-43-48(45-22-8-2-9-23-45)37-41-57(54)69(56)62-66-61(67-63(68-62)71-60-33-19-18-32-59(60)70-58-31-17-16-30-55(58)65-64(70)71)46-34-38-52(39-35-46)72(49-24-10-3-11-25-49,50-26-12-4-13-27-50)51-28-14-5-15-29-51/h1-43H |
| InChIKey | SYKXJZHQTODZKB-UHFFFAOYSA-N |
| XLogP | 12.09 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.18 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|