C12H21N — CID 168828324
(3S)-6-cyclohexyl-3-methyl-1,2,3,4-tetrahydropyridine (PubChem CID 168828324) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (3S)-6-cyclohexyl-3-methyl-1,2,3,4-tetrahydropyridine.
| Compound Name | (3S)-6-cyclohexyl-3-methyl-1,2,3,4-tetrahydropyridine |
|---|---|
| PubChem CID | 168828324 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (3S)-6-cyclohexyl-3-methyl-1,2,3,4-tetrahydropyridine |
| SMILES | C[C@H]1CC=C(C2CCCCC2)NC1 |
| InChI | InChI=1S/C12H21N/c1-10-7-8-12(13-9-10)11-5-3-2-4-6-11/h8,10-11,13H,2-7,9H2,1H3/t10-/m0/s1 |
| InChIKey | ZPAZNVCPVMAQBH-JTQLQIEISA-N |
| XLogP | 3.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |