C8H15N — CID 21326805
2,4,6-trimethyl-1,2,3,4-tetrahydropyridine (PubChem CID 21326805) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is 2,4,6-trimethyl-1,2,3,4-tetrahydropyridine.
| Compound Name | 2,4,6-trimethyl-1,2,3,4-tetrahydropyridine |
|---|---|
| PubChem CID | 21326805 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 2,4,6-trimethyl-1,2,3,4-tetrahydropyridine |
| SMILES | CC1=CC(C)CC(C)N1 |
| InChI | InChI=1S/C8H15N/c1-6-4-7(2)9-8(3)5-6/h4,6,8-9H,5H2,1-3H3 |
| InChIKey | GYZLPQOUASDQLR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |