C36H28N2OS+2 — CID 168829390
3',5,6,18,19-pentamethylspiro[23-oxa-20-thia-8-azoniahexacyclo[11.10.0.02,10.03,8.014,22.017,21]tricosa-1(13),2(10),3(8),4,6,11,14(22),15,17(21),18-decaene-9,6'-pyrido[2,1-a]isoindol-5-ium] (PubChem CID 168829390) has the molecular formula C36H28N2OS+2 and a molecular weight of 536.70 g/mol. Its IUPAC name is 3',5,6,18,19-pentamethylspiro[23-oxa-20-thia-8-azoniahexacyclo[11.10.0.02,10.03,8.014,22.017,21]tricosa-1(13),2(10),3(8),4,6,11,14(22),15,17(21),18-decaene-9,6'-pyrido[2,1-a]isoindol-5-ium].
| Compound Name | 3',5,6,18,19-pentamethylspiro[23-oxa-20-thia-8-azoniahexacyclo[11.10.0.02,10.03,8.014,22.017,21]tricosa-1(13),2(10),3(8),4,6,11,14(22),15,17(21),18-decaene-9,6'-pyrido[2,1-a]isoindol-5-ium] |
|---|---|
| PubChem CID | 168829390 |
| Molecular Formula | C36H28N2OS+2 |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | 3',5,6,18,19-pentamethylspiro[23-oxa-20-thia-8-azoniahexacyclo[11.10.0.02,10.03,8.014,22.017,21]tricosa-1(13),2(10),3(8),4,6,11,14(22),15,17(21),18-decaene-9,6'-pyrido[2,1-a]isoindol-5-ium] |
| SMILES | Cc1ccc2[n+](c1)C1(c3ccccc3-2)c2ccc3c(oc4c3ccc3c(C)c(C)sc34)c2-c2cc(C)c(C)c[n+]21 |
| InChI | InChI=1S/C36H28N2OS/c1-19-10-15-30-27-8-6-7-9-28(27)36(37(30)17-19)29-14-13-25-26-12-11-24-22(4)23(5)40-35(24)34(26)39-33(25)32(29)31-16-20(2)21(3)18-38(31)36/h6-18H,1-5H3/q+2 |
| InChIKey | GVGKAVSTXSFOJJ-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 20.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|