C36H36N2O+2 — CID 158286957
6-tert-butyl-2',3',8'-trimethylspiro[20-oxa-8-azoniapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14(19)-heptaene-9,6'-pyrido[2,1-a]isoindol-5-ium] (PubChem CID 158286957) has the molecular formula C36H36N2O+2 and a molecular weight of 512.70 g/mol. Its IUPAC name is 6-tert-butyl-2',3',8'-trimethylspiro[20-oxa-8-azoniapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14(19)-heptaene-9,6'-pyrido[2,1-a]isoindol-5-ium].
| Compound Name | 6-tert-butyl-2',3',8'-trimethylspiro[20-oxa-8-azoniapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14(19)-heptaene-9,6'-pyrido[2,1-a]isoindol-5-ium] |
|---|---|
| PubChem CID | 158286957 |
| Molecular Formula | C36H36N2O+2 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | 6-tert-butyl-2',3',8'-trimethylspiro[20-oxa-8-azoniapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14(19)-heptaene-9,6'-pyrido[2,1-a]isoindol-5-ium] |
| SMILES | Cc1ccc2c(c1)C1(c3ccc4c5c(oc4c3-c3ccc(C(C)(C)C)c[n+]31)CCCC5)[n+]1cc(C)c(C)cc1-2 |
| InChI | InChI=1S/C36H36N2O/c1-21-11-13-27-29(17-21)36(37-19-23(3)22(2)18-31(27)37)28-15-14-26-25-9-7-8-10-32(25)39-34(26)33(28)30-16-12-24(20-38(30)36)35(4,5)6/h11-20H,7-10H2,1-6H3/q+2 |
| InChIKey | AARYRWAWNZHPIA-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 20.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|