C40H30IrN2OS-2 — CID 168829831
4-(2,6-dimethylphenyl)-5-methyl-2-(2-methyl-8H-[1]benzothiolo[4,5-b][1]benzofuran-8-id-9-yl)pyridine;iridium;2-phenylpyridine (PubChem CID 168829831) has the molecular formula C40H30IrN2OS-2 and a molecular weight of 778.98 g/mol. Its IUPAC name is 4-(2,6-dimethylphenyl)-5-methyl-2-(2-methyl-8H-[1]benzothiolo[4,5-b][1]benzofuran-8-id-9-yl)pyridine;iridium;2-phenylpyridine.
| Compound Name | 4-(2,6-dimethylphenyl)-5-methyl-2-(2-methyl-8H-[1]benzothiolo[4,5-b][1]benzofuran-8-id-9-yl)pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 168829831 |
| Molecular Formula | C40H30IrN2OS-2 |
| Molecular Weight | 778.98 g/mol |
| Exact Mass | 779.17 |
| IUPAC Name | 4-(2,6-dimethylphenyl)-5-methyl-2-(2-methyl-8H-[1]benzothiolo[4,5-b][1]benzofuran-8-id-9-yl)pyridine;iridium;2-phenylpyridine |
| SMILES | Cc1cc2c(ccc3c4cc[c-]c(-c5cc(-c6c(C)cccc6C)c(C)cn5)c4oc23)s1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C29H22NOS.C11H8N.Ir/c1-16-7-5-8-17(2)27(16)23-14-25(30-15-18(23)3)22-10-6-9-20-21-11-12-26-24(13-19(4)32-26)29(21)31-28(20)22;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h5-9,11-15H,1-4H3;1-6,8-9H;/q2*-1; |
| InChIKey | ZFVQASKDZOMTBE-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.98 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|