C45H40IrN2OS-2 — CID 168829963
5-(1,1-dideuterio-2,2-dimethylpropyl)-2-(1,2-dimethyl-8H-[1]benzothiolo[4,5-b][1]benzofuran-8-id-9-yl)-4-(2,6-dimethylphenyl)pyridine;iridium;2-phenylpyridine (PubChem CID 168829963) has the molecular formula C45H40IrN2OS-2 and a molecular weight of 851.12 g/mol. Its IUPAC name is 5-(1,1-dideuterio-2,2-dimethylpropyl)-2-(1,2-dimethyl-8H-[1]benzothiolo[4,5-b][1]benzofuran-8-id-9-yl)-4-(2,6-dimethylphenyl)pyridine;iridium;2-phenylpyridine.
| Compound Name | 5-(1,1-dideuterio-2,2-dimethylpropyl)-2-(1,2-dimethyl-8H-[1]benzothiolo[4,5-b][1]benzofuran-8-id-9-yl)-4-(2,6-dimethylphenyl)pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 168829963 |
| Molecular Formula | C45H40IrN2OS-2 |
| Molecular Weight | 851.12 g/mol |
| Exact Mass | 851.26 |
| IUPAC Name | 5-(1,1-dideuterio-2,2-dimethylpropyl)-2-(1,2-dimethyl-8H-[1]benzothiolo[4,5-b][1]benzofuran-8-id-9-yl)-4-(2,6-dimethylphenyl)pyridine;iridium;2-phenylpyridine |
| SMILES | [2H]C([2H])(c1cnc(-c2[c-]ccc3c2oc2c3ccc3sc(C)c(C)c32)cc1-c1c(C)cccc1C)C(C)(C)C.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C34H32NOS.C11H8N.Ir/c1-19-10-8-11-20(2)30(19)27-16-28(35-18-23(27)17-34(5,6)7)26-13-9-12-24-25-14-15-29-31(21(3)22(4)37-29)33(25)36-32(24)26;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h8-12,14-16,18H,17H2,1-7H3;1-6,8-9H;/q2*-1;/i17D2;; |
| InChIKey | ULNPPFQFEWDPPY-MXXAFVANSA-N |
| XLogP | 12.70 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.12 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|