C26H33ClN8O4S — CID 168833399
tert-butyl (2R)-4-[6-[(Z)-N'-[(4S)-2-amino-3-cyano-4-methyl-6,7-dihydro-5H-1-benzothiophene-4-carbonyl]oxycarbamimidoyl]-2-chloropyrimidin-4-yl]-2-methylpiperazine-1-carboxylate (PubChem CID 168833399) has the molecular formula C26H33ClN8O4S and a molecular weight of 589.12 g/mol. Its IUPAC name is tert-butyl (2R)-4-[6-[(Z)-N'-[(4S)-2-amino-3-cyano-4-methyl-6,7-dihydro-5H-1-benzothiophene-4-carbonyl]oxycarbamimidoyl]-2-chloropyrimidin-4-yl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-[6-[(Z)-N'-[(4S)-2-amino-3-cyano-4-methyl-6,7-dihydro-5H-1-benzothiophene-4-carbonyl]oxycarbamimidoyl]-2-chloropyrimidin-4-yl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 168833399 |
| Molecular Formula | C26H33ClN8O4S |
| Molecular Weight | 589.12 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | tert-butyl (2R)-4-[6-[(Z)-N'-[(4S)-2-amino-3-cyano-4-methyl-6,7-dihydro-5H-1-benzothiophene-4-carbonyl]oxycarbamimidoyl]-2-chloropyrimidin-4-yl]-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(c2cc(/C(N)=N/OC(=O)[C@@]3(C)CCCc4sc(N)c(C#N)c43)nc(Cl)n2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H33ClN8O4S/c1-14-13-34(9-10-35(14)24(37)38-25(2,3)4)18-11-16(31-23(27)32-18)20(29)33-39-22(36)26(5)8-6-7-17-19(26)15(12-28)21(30)40-17/h11,14H,6-10,13,30H2,1-5H3,(H2,29,33)/t14-,26+/m1/s1 |
| InChIKey | FHYUIKGKNIJXOP-PTFIGZPYSA-N |
| XLogP | 3.55 |
| TPSA | 173.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.12 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|