C33H46N8O5S — CID 162376071
tert-butyl 4-[[2-[(E)-N'-(2-amino-3-cyano-4-methyl-6,7-dihydro-5H-1-benzothiophene-4-carbonyl)oxycarbamimidoyl]-6-(4-methylpiperazin-1-yl)-4-pyridinyl]oxy]azepane-1-carboxylate (PubChem CID 162376071) has the molecular formula C33H46N8O5S and a molecular weight of 666.85 g/mol. Its IUPAC name is tert-butyl 4-[[2-[(E)-N'-(2-amino-3-cyano-4-methyl-6,7-dihydro-5H-1-benzothiophene-4-carbonyl)oxycarbamimidoyl]-6-(4-methylpiperazin-1-yl)-4-pyridinyl]oxy]azepane-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-[(E)-N'-(2-amino-3-cyano-4-methyl-6,7-dihydro-5H-1-benzothiophene-4-carbonyl)oxycarbamimidoyl]-6-(4-methylpiperazin-1-yl)-4-pyridinyl]oxy]azepane-1-carboxylate |
|---|---|
| PubChem CID | 162376071 |
| Molecular Formula | C33H46N8O5S |
| Molecular Weight | 666.85 g/mol |
| Exact Mass | 666.33 |
| IUPAC Name | tert-butyl 4-[[2-[(E)-N'-(2-amino-3-cyano-4-methyl-6,7-dihydro-5H-1-benzothiophene-4-carbonyl)oxycarbamimidoyl]-6-(4-methylpiperazin-1-yl)-4-pyridinyl]oxy]azepane-1-carboxylate |
| SMILES | CN1CCN(c2cc(OC3CCCN(C(=O)OC(C)(C)C)CC3)cc(/C(N)=N\OC(=O)C3(C)CCCc4sc(N)c(C#N)c43)n2)CC1 |
| InChI | InChI=1S/C33H46N8O5S/c1-32(2,3)45-31(43)41-12-7-8-21(10-13-41)44-22-18-24(37-26(19-22)40-16-14-39(5)15-17-40)28(35)38-46-30(42)33(4)11-6-9-25-27(33)23(20-34)29(36)47-25/h18-19,21H,6-17,36H2,1-5H3,(H2,35,38) |
| InChIKey | DOYDWYBNZGVCGT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 172.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.85 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|