C21H34N6O3 — CID 162375837
tert-butyl 4-[[2-carbamimidoyl-6-(4-methylpiperazin-1-yl)-4-pyridinyl]oxy]piperidine-1-carboxylate (PubChem CID 162375837) has the molecular formula C21H34N6O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is tert-butyl 4-[[2-carbamimidoyl-6-(4-methylpiperazin-1-yl)-4-pyridinyl]oxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-carbamimidoyl-6-(4-methylpiperazin-1-yl)-4-pyridinyl]oxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 162375837 |
| Molecular Formula | C21H34N6O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | tert-butyl 4-[[2-carbamimidoyl-6-(4-methylpiperazin-1-yl)-4-pyridinyl]oxy]piperidine-1-carboxylate |
| SMILES | [H]/N=C(\N)c1cc(OC2CCN(C(=O)OC(C)(C)C)CC2)cc(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C21H34N6O3/c1-21(2,3)30-20(28)27-7-5-15(6-8-27)29-16-13-17(19(22)23)24-18(14-16)26-11-9-25(4)10-12-26/h13-15H,5-12H2,1-4H3,(H3,22,23) |
| InChIKey | IUKHBHKQSVHCIZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|