C17H22F3N3O4 — CID 86666505
tert-butyl 4-[[4-carbamoyl-6-(trifluoromethyl)-2-pyridinyl]oxy]piperidine-1-carboxylate (PubChem CID 86666505) has the molecular formula C17H22F3N3O4 and a molecular weight of 389.37 g/mol. Its IUPAC name is tert-butyl 4-[[4-carbamoyl-6-(trifluoromethyl)-2-pyridinyl]oxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-carbamoyl-6-(trifluoromethyl)-2-pyridinyl]oxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86666505 |
| Molecular Formula | C17H22F3N3O4 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | tert-butyl 4-[[4-carbamoyl-6-(trifluoromethyl)-2-pyridinyl]oxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2cc(C(N)=O)cc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C17H22F3N3O4/c1-16(2,3)27-15(25)23-6-4-11(5-7-23)26-13-9-10(14(21)24)8-12(22-13)17(18,19)20/h8-9,11H,4-7H2,1-3H3,(H2,21,24) |
| InChIKey | GAHRKFICDAXBRI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |