C22H37N6O3+ — CID 162375996
[amino-[6-(4-methylpiperazin-1-yl)-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]azepan-4-yl]oxy-2-pyridinyl]methylidene]azanium (PubChem CID 162375996) has the molecular formula C22H37N6O3+ and a molecular weight of 433.58 g/mol. Its IUPAC name is [amino-[6-(4-methylpiperazin-1-yl)-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]azepan-4-yl]oxy-2-pyridinyl]methylidene]azanium.
| Compound Name | [amino-[6-(4-methylpiperazin-1-yl)-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]azepan-4-yl]oxy-2-pyridinyl]methylidene]azanium |
|---|---|
| PubChem CID | 162375996 |
| Molecular Formula | C22H37N6O3+ |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | [amino-[6-(4-methylpiperazin-1-yl)-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]azepan-4-yl]oxy-2-pyridinyl]methylidene]azanium |
| SMILES | CN1CCN(c2cc(OC3CCCN(C(=O)OC(C)(C)C)CC3)cc(C(N)=[NH2+])n2)CC1 |
| InChI | InChI=1S/C22H36N6O3/c1-22(2,3)31-21(29)28-8-5-6-16(7-9-28)30-17-14-18(20(23)24)25-19(15-17)27-12-10-26(4)11-13-27/h14-16H,5-13H2,1-4H3,(H3,23,24)/p+1 |
| InChIKey | JVGDCKCSGNYIFO-UHFFFAOYSA-O |
| XLogP | 0.47 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|