C16H20N4O2S — CID 16883530
1-[4-(6-ethoxypyridazin-3-yl)piperazin-1-yl]-2-thiophen-2-ylethanone (PubChem CID 16883530) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is 1-[4-(6-ethoxypyridazin-3-yl)piperazin-1-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[4-(6-ethoxypyridazin-3-yl)piperazin-1-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 16883530 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-[4-(6-ethoxypyridazin-3-yl)piperazin-1-yl]-2-thiophen-2-ylethanone |
| SMILES | CCOc1ccc(N2CCN(C(=O)Cc3cccs3)CC2)nn1 |
| InChI | InChI=1S/C16H20N4O2S/c1-2-22-15-6-5-14(17-18-15)19-7-9-20(10-8-19)16(21)12-13-4-3-11-23-13/h3-6,11H,2,7-10,12H2,1H3 |
| InChIKey | RGLOBLONKKSTGI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |