C21H27N5O5S — CID 16883540
[4-(6-ethoxypyridazin-3-yl)piperazin-1-yl]-(4-morpholin-4-ylsulfonylphenyl)methanone (PubChem CID 16883540) has the molecular formula C21H27N5O5S and a molecular weight of 461.54 g/mol. Its IUPAC name is [4-(6-ethoxypyridazin-3-yl)piperazin-1-yl]-(4-morpholin-4-ylsulfonylphenyl)methanone.
| Compound Name | [4-(6-ethoxypyridazin-3-yl)piperazin-1-yl]-(4-morpholin-4-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 16883540 |
| Molecular Formula | C21H27N5O5S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | [4-(6-ethoxypyridazin-3-yl)piperazin-1-yl]-(4-morpholin-4-ylsulfonylphenyl)methanone |
| SMILES | CCOc1ccc(N2CCN(C(=O)c3ccc(S(=O)(=O)N4CCOCC4)cc3)CC2)nn1 |
| InChI | InChI=1S/C21H27N5O5S/c1-2-31-20-8-7-19(22-23-20)24-9-11-25(12-10-24)21(27)17-3-5-18(6-4-17)32(28,29)26-13-15-30-16-14-26/h3-8H,2,9-16H2,1H3 |
| InChIKey | OSEHGNGRBQKEJF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 105.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |